C10H14O6 — CID 101055807
methyl (1R,3aR,4R,5S,6aR)-5-hydroxy-1-methoxy-3-oxo-1,3a,4,5,6,6a-hexahydrocyclopenta[c]furan-4-carboxylate (PubChem CID 101055807) has the molecular formula C10H14O6 and a molecular weight of 230.22 g/mol. Its IUPAC name is methyl (1R,3aR,4R,5S,6aR)-5-hydroxy-1-methoxy-3-oxo-1,3a,4,5,6,6a-hexahydrocyclopenta[c]furan-4-carboxylate.
| Compound Name | methyl (1R,3aR,4R,5S,6aR)-5-hydroxy-1-methoxy-3-oxo-1,3a,4,5,6,6a-hexahydrocyclopenta[c]furan-4-carboxylate |
|---|---|
| PubChem CID | 101055807 |
| Molecular Formula | C10H14O6 |
| Molecular Weight | 230.22 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | methyl (1R,3aR,4R,5S,6aR)-5-hydroxy-1-methoxy-3-oxo-1,3a,4,5,6,6a-hexahydrocyclopenta[c]furan-4-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@@H]2C(=O)O[C@@H](OC)[C@@H]2C[C@@H]1O |
| InChI | InChI=1S/C10H14O6/c1-14-8(12)7-5(11)3-4-6(7)9(13)16-10(4)15-2/h4-7,10-11H,3H2,1-2H3/t4-,5+,6-,7+,10-/m1/s1 |
| InChIKey | AZAQJBRMGUMOLO-DJBGLHMESA-N |
| XLogP | -0.70 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.22 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |