C9H14O4 — CID 172645651
(3aR,6S,6aS)-6-(methoxymethoxy)-1,3a,4,5,6,6a-hexahydrocyclopenta[c]furan-3-one (PubChem CID 172645651) has the molecular formula C9H14O4 and a molecular weight of 186.21 g/mol. Its IUPAC name is (3aR,6S,6aS)-6-(methoxymethoxy)-1,3a,4,5,6,6a-hexahydrocyclopenta[c]furan-3-one.
| Compound Name | (3aR,6S,6aS)-6-(methoxymethoxy)-1,3a,4,5,6,6a-hexahydrocyclopenta[c]furan-3-one |
|---|---|
| PubChem CID | 172645651 |
| Molecular Formula | C9H14O4 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | (3aR,6S,6aS)-6-(methoxymethoxy)-1,3a,4,5,6,6a-hexahydrocyclopenta[c]furan-3-one |
| SMILES | COCO[C@H]1CC[C@H]2C(=O)OC[C@@H]12 |
| InChI | InChI=1S/C9H14O4/c1-11-5-13-8-3-2-6-7(8)4-12-9(6)10/h6-8H,2-5H2,1H3/t6-,7-,8+/m1/s1 |
| InChIKey | UCBYOLOODNLLDJ-PRJMDXOYSA-N |
| XLogP | 0.56 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|