methyl 2-[(2S,4R)-2-methoxy-4-(methoxymethoxy)oxan-2-yl]acetate

C11H20O6 — CID 101055946

IUPACmethyl 2-[(2S,4R)-2-methoxy-4-(methoxymethoxy)oxan-2-yl]acetate
SMILESCOCO[C@@H]1CCO[C@@](CC(=O)OC)(OC)C1
InChIInChI=1S/C11H20O6/c1-13-8-16-9-4-5-17-11(6-9,15-3)7-10(12)14-2/h9H,4-8H2,1-3H3/t9-,11+/m1/s1
InChIKeyCVGKIOJZZPWTLM-KOLCDFICSA-N
MW248.27 g/mol
LogP0.69
Rot. Bonds6

About methyl 2-[(2S,4R)-2-methoxy-4-(methoxymethoxy)oxan-2-yl]acetate

methyl 2-[(2S,4R)-2-methoxy-4-(methoxymethoxy)oxan-2-yl]acetate (PubChem CID 101055946) has the molecular formula C11H20O6 and a molecular weight of 248.27 g/mol. Its IUPAC name is methyl 2-[(2S,4R)-2-methoxy-4-(methoxymethoxy)oxan-2-yl]acetate.

Molecular Properties

Compound Namemethyl 2-[(2S,4R)-2-methoxy-4-(methoxymethoxy)oxan-2-yl]acetate
PubChem CID101055946
Molecular FormulaC11H20O6
Molecular Weight248.27 g/mol
Exact Mass248.13
IUPAC Namemethyl 2-[(2S,4R)-2-methoxy-4-(methoxymethoxy)oxan-2-yl]acetate
SMILESCOCO[C@@H]1CCO[C@@](CC(=O)OC)(OC)C1
InChIInChI=1S/C11H20O6/c1-13-8-16-9-4-5-17-11(6-9,15-3)7-10(12)14-2/h9H,4-8H2,1-3H3/t9-,11+/m1/s1
InChIKeyCVGKIOJZZPWTLM-KOLCDFICSA-N
XLogP0.69
TPSA63.22 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds6
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500248.27
LogP ≤ 50.69
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}

Analyze methyl 2-[(2S,4R)-2-methoxy-4-(methoxymethoxy)oxan-2-yl]acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[(2S,4R)-2-methoxy-4-(methoxymethoxy)oxan-2-yl]acetate?
The IUPAC name of methyl 2-[(2S,4R)-2-methoxy-4-(methoxymethoxy)oxan-2-yl]acetate (CID 101055946) is methyl 2-[(2S,4R)-2-methoxy-4-(methoxymethoxy)oxan-2-yl]acetate.
What is the SMILES notation for methyl 2-[(2S,4R)-2-methoxy-4-(methoxymethoxy)oxan-2-yl]acetate?
The canonical SMILES for methyl 2-[(2S,4R)-2-methoxy-4-(methoxymethoxy)oxan-2-yl]acetate is COCO[C@@H]1CCO[C@@](CC(=O)OC)(OC)C1.
What is the InChIKey of methyl 2-[(2S,4R)-2-methoxy-4-(methoxymethoxy)oxan-2-yl]acetate?
The InChIKey is CVGKIOJZZPWTLM-KOLCDFICSA-N. The full InChI is InChI=1S/C11H20O6/c1-13-8-16-9-4-5-17-11(6-9,15-3)7-10(12)14-2/h9H,4-8H2,1-3H3/t9-,11+/m1/s1.
What are the key properties of methyl 2-[(2S,4R)-2-methoxy-4-(methoxymethoxy)oxan-2-yl]acetate?
methyl 2-[(2S,4R)-2-methoxy-4-(methoxymethoxy)oxan-2-yl]acetate has a molecular weight of 248.27 g/mol, XLogP of 0.69, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(2S,4R)-2-methoxy-4-(methoxymethoxy)oxan-2-yl]acetate is sourced from PubChem (CID 101055946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).