C11H20O6 — CID 101055946
methyl 2-[(2S,4R)-2-methoxy-4-(methoxymethoxy)oxan-2-yl]acetate (PubChem CID 101055946) has the molecular formula C11H20O6 and a molecular weight of 248.27 g/mol. Its IUPAC name is methyl 2-[(2S,4R)-2-methoxy-4-(methoxymethoxy)oxan-2-yl]acetate.
| Compound Name | methyl 2-[(2S,4R)-2-methoxy-4-(methoxymethoxy)oxan-2-yl]acetate |
|---|---|
| PubChem CID | 101055946 |
| Molecular Formula | C11H20O6 |
| Molecular Weight | 248.27 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | methyl 2-[(2S,4R)-2-methoxy-4-(methoxymethoxy)oxan-2-yl]acetate |
| SMILES | COCO[C@@H]1CCO[C@@](CC(=O)OC)(OC)C1 |
| InChI | InChI=1S/C11H20O6/c1-13-8-16-9-4-5-17-11(6-9,15-3)7-10(12)14-2/h9H,4-8H2,1-3H3/t9-,11+/m1/s1 |
| InChIKey | CVGKIOJZZPWTLM-KOLCDFICSA-N |
| XLogP | 0.69 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.27 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|