C20H48N2O7Si6 — CID 101056715
3-isocyanatopropyl-[[[[[3-isocyanatopropyl(dimethyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilane (PubChem CID 101056715) has the molecular formula C20H48N2O7Si6 and a molecular weight of 597.13 g/mol. Its IUPAC name is 3-isocyanatopropyl-[[[[[3-isocyanatopropyl(dimethyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilane.
| Compound Name | 3-isocyanatopropyl-[[[[[3-isocyanatopropyl(dimethyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 101056715 |
| Molecular Formula | C20H48N2O7Si6 |
| Molecular Weight | 597.13 g/mol |
| Exact Mass | 596.21 |
| IUPAC Name | 3-isocyanatopropyl-[[[[[3-isocyanatopropyl(dimethyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilane |
| SMILES | C[Si](C)(CCCN=C=O)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)CCCN=C=O |
| InChI | InChI=1S/C20H48N2O7Si6/c1-30(2,17-13-15-21-19-23)25-32(5,6)27-34(9,10)29-35(11,12)28-33(7,8)26-31(3,4)18-14-16-22-20-24/h13-18H2,1-12H3 |
| InChIKey | CLFIYCZQNCHZQT-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 105.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.13 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|