C14H38N6O2Si3 — CID 147437476
2-[3-[[[3-(diaminomethylideneamino)propyl-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]propyl]guanidine (PubChem CID 147437476) has the molecular formula C14H38N6O2Si3 and a molecular weight of 406.76 g/mol. Its IUPAC name is 2-[3-[[[3-(diaminomethylideneamino)propyl-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]propyl]guanidine.
| Compound Name | 2-[3-[[[3-(diaminomethylideneamino)propyl-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]propyl]guanidine |
|---|---|
| PubChem CID | 147437476 |
| Molecular Formula | C14H38N6O2Si3 |
| Molecular Weight | 406.76 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | 2-[3-[[[3-(diaminomethylideneamino)propyl-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]propyl]guanidine |
| SMILES | C[Si](C)(CCCN=C(N)N)O[Si](C)(C)O[Si](C)(C)CCCN=C(N)N |
| InChI | InChI=1S/C14H38N6O2Si3/c1-23(2,11-7-9-19-13(15)16)21-25(5,6)22-24(3,4)12-8-10-20-14(17)18/h7-12H2,1-6H3,(H4,15,16,19)(H4,17,18,20) |
| InChIKey | DVOJSZBYFQGGOU-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 147.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.76 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|