C20H48O2Si3 — CID 164822475
bis[[4,4-dimethylpentyl(dimethyl)silyl]oxy]-dimethylsilane (PubChem CID 164822475) has the molecular formula C20H48O2Si3 and a molecular weight of 404.86 g/mol. Its IUPAC name is bis[[4,4-dimethylpentyl(dimethyl)silyl]oxy]-dimethylsilane.
| Compound Name | bis[[4,4-dimethylpentyl(dimethyl)silyl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 164822475 |
| Molecular Formula | C20H48O2Si3 |
| Molecular Weight | 404.86 g/mol |
| Exact Mass | 404.30 |
| IUPAC Name | bis[[4,4-dimethylpentyl(dimethyl)silyl]oxy]-dimethylsilane |
| SMILES | CC(C)(C)CCC[Si](C)(C)O[Si](C)(C)O[Si](C)(C)CCCC(C)(C)C |
| InChI | InChI=1S/C20H48O2Si3/c1-19(2,3)15-13-17-23(7,8)21-25(11,12)22-24(9,10)18-14-16-20(4,5)6/h13-18H2,1-12H3 |
| InChIKey | MIQQYDUKGQSZLY-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.86 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|