C13H25N2O2 — CID 10105754
CID 10105754 (PubChem CID 10105754) has the molecular formula C13H25N2O2 and a molecular weight of 241.35 g/mol.
| Compound Name | CID 10105754 |
|---|---|
| PubChem CID | 10105754 |
| Molecular Formula | C13H25N2O2 |
| Molecular Weight | 241.35 g/mol |
| Exact Mass | 241.19 |
| IUPAC Name | — |
| SMILES | CCCCNC(=O)C1CC(C)(C)N([O])C1(C)C |
| InChI | InChI=1S/C13H25N2O2/c1-6-7-8-14-11(16)10-9-12(2,3)15(17)13(10,4)5/h10H,6-9H2,1-5H3,(H,14,16) |
| InChIKey | BXWCIPZMAQNVAI-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 52.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.35 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|