C11H18N2O — CID 103837485
N-(4-cyanobutyl)-2,2-dimethylcyclopropane-1-carboxamide (PubChem CID 103837485) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is N-(4-cyanobutyl)-2,2-dimethylcyclopropane-1-carboxamide.
| Compound Name | N-(4-cyanobutyl)-2,2-dimethylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 103837485 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | N-(4-cyanobutyl)-2,2-dimethylcyclopropane-1-carboxamide |
| SMILES | CC1(C)CC1C(=O)NCCCCC#N |
| InChI | InChI=1S/C11H18N2O/c1-11(2)8-9(11)10(14)13-7-5-3-4-6-12/h9H,3-5,7-8H2,1-2H3,(H,13,14) |
| InChIKey | WBBZSWJYFWNOKB-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|