C9H14N2O — CID 130628725
(1S)-N-(2-cyanoethyl)-2,2-dimethylcyclopropane-1-carboxamide (PubChem CID 130628725) has the molecular formula C9H14N2O and a molecular weight of 166.22 g/mol. Its IUPAC name is (1S)-N-(2-cyanoethyl)-2,2-dimethylcyclopropane-1-carboxamide.
| Compound Name | (1S)-N-(2-cyanoethyl)-2,2-dimethylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 130628725 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.11 |
| IUPAC Name | (1S)-N-(2-cyanoethyl)-2,2-dimethylcyclopropane-1-carboxamide |
| SMILES | CC1(C)C[C@@H]1C(=O)NCCC#N |
| InChI | InChI=1S/C9H14N2O/c1-9(2)6-7(9)8(12)11-5-3-4-10/h7H,3,5-6H2,1-2H3,(H,11,12)/t7-/m1/s1 |
| InChIKey | PUZYAHVRLALHCH-SSDOTTSWSA-N |
| XLogP | 1.06 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|