C21H20F3NO6 — CID 101061214
dimethyl (2R)-2-[[(1S)-1-naphthalen-1-ylethyl]-(2,2,2-trifluoroacetyl)amino]-4-oxopentanedioate (PubChem CID 101061214) has the molecular formula C21H20F3NO6 and a molecular weight of 439.39 g/mol. Its IUPAC name is dimethyl (2R)-2-[[(1S)-1-naphthalen-1-ylethyl]-(2,2,2-trifluoroacetyl)amino]-4-oxopentanedioate.
| Compound Name | dimethyl (2R)-2-[[(1S)-1-naphthalen-1-ylethyl]-(2,2,2-trifluoroacetyl)amino]-4-oxopentanedioate |
|---|---|
| PubChem CID | 101061214 |
| Molecular Formula | C21H20F3NO6 |
| Molecular Weight | 439.39 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | dimethyl (2R)-2-[[(1S)-1-naphthalen-1-ylethyl]-(2,2,2-trifluoroacetyl)amino]-4-oxopentanedioate |
| SMILES | COC(=O)C(=O)C[C@H](C(=O)OC)N(C(=O)C(F)(F)F)[C@@H](C)c1cccc2ccccc12 |
| InChI | InChI=1S/C21H20F3NO6/c1-12(14-10-6-8-13-7-4-5-9-15(13)14)25(20(29)21(22,23)24)16(18(27)30-2)11-17(26)19(28)31-3/h4-10,12,16H,11H2,1-3H3/t12-,16+/m0/s1 |
| InChIKey | ROYZMZKTUKINCK-BLLLJJGKSA-N |
| XLogP | 2.97 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.39 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|