C17H18F3NO6 — CID 11222985
dimethyl (4S)-2-oxo-4-[[(1R)-1-phenylethyl]-(2,2,2-trifluoroacetyl)amino]pentanedioate (PubChem CID 11222985) has the molecular formula C17H18F3NO6 and a molecular weight of 389.33 g/mol. Its IUPAC name is dimethyl (4S)-2-oxo-4-[[(1R)-1-phenylethyl]-(2,2,2-trifluoroacetyl)amino]pentanedioate.
| Compound Name | dimethyl (4S)-2-oxo-4-[[(1R)-1-phenylethyl]-(2,2,2-trifluoroacetyl)amino]pentanedioate |
|---|---|
| PubChem CID | 11222985 |
| Molecular Formula | C17H18F3NO6 |
| Molecular Weight | 389.33 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | dimethyl (4S)-2-oxo-4-[[(1R)-1-phenylethyl]-(2,2,2-trifluoroacetyl)amino]pentanedioate |
| SMILES | COC(=O)C(=O)C[C@@H](C(=O)OC)N(C(=O)C(F)(F)F)[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C17H18F3NO6/c1-10(11-7-5-4-6-8-11)21(16(25)17(18,19)20)12(14(23)26-2)9-13(22)15(24)27-3/h4-8,10,12H,9H2,1-3H3/t10-,12+/m1/s1 |
| InChIKey | TWFYLXFPPRZJCN-PWSUYJOCSA-N |
| XLogP | 1.81 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.33 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|