C15H18FNO5 — CID 90774139
methyl 4-[(4-fluorophenyl)methyl-(2-methoxyethyl)amino]-2,4-dioxobutanoate (PubChem CID 90774139) has the molecular formula C15H18FNO5 and a molecular weight of 311.31 g/mol. Its IUPAC name is methyl 4-[(4-fluorophenyl)methyl-(2-methoxyethyl)amino]-2,4-dioxobutanoate.
| Compound Name | methyl 4-[(4-fluorophenyl)methyl-(2-methoxyethyl)amino]-2,4-dioxobutanoate |
|---|---|
| PubChem CID | 90774139 |
| Molecular Formula | C15H18FNO5 |
| Molecular Weight | 311.31 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | methyl 4-[(4-fluorophenyl)methyl-(2-methoxyethyl)amino]-2,4-dioxobutanoate |
| SMILES | COCCN(Cc1ccc(F)cc1)C(=O)CC(=O)C(=O)OC |
| InChI | InChI=1S/C15H18FNO5/c1-21-8-7-17(10-11-3-5-12(16)6-4-11)14(19)9-13(18)15(20)22-2/h3-6H,7-10H2,1-2H3 |
| InChIKey | AJCJPPINUMKGLR-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.31 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|