C18H24FNO4 — CID 24807287
methyl (2S)-2-[(4-fluorophenyl)methyl-(3-oxobutanoyl)amino]-4-methylpentanoate (PubChem CID 24807287) has the molecular formula C18H24FNO4 and a molecular weight of 337.39 g/mol. Its IUPAC name is methyl (2S)-2-[(4-fluorophenyl)methyl-(3-oxobutanoyl)amino]-4-methylpentanoate.
| Compound Name | methyl (2S)-2-[(4-fluorophenyl)methyl-(3-oxobutanoyl)amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 24807287 |
| Molecular Formula | C18H24FNO4 |
| Molecular Weight | 337.39 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | methyl (2S)-2-[(4-fluorophenyl)methyl-(3-oxobutanoyl)amino]-4-methylpentanoate |
| SMILES | COC(=O)[C@H](CC(C)C)N(Cc1ccc(F)cc1)C(=O)CC(C)=O |
| InChI | InChI=1S/C18H24FNO4/c1-12(2)9-16(18(23)24-4)20(17(22)10-13(3)21)11-14-5-7-15(19)8-6-14/h5-8,12,16H,9-11H2,1-4H3/t16-/m0/s1 |
| InChIKey | VFUFFWVMLNSNCL-INIZCTEOSA-N |
| XLogP | 2.72 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.39 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|