C15H18FNO4 — CID 90684752
methyl 4-[(4-fluorophenyl)methyl-propan-2-ylamino]-2,4-dioxobutanoate (PubChem CID 90684752) has the molecular formula C15H18FNO4 and a molecular weight of 295.31 g/mol. Its IUPAC name is methyl 4-[(4-fluorophenyl)methyl-propan-2-ylamino]-2,4-dioxobutanoate.
| Compound Name | methyl 4-[(4-fluorophenyl)methyl-propan-2-ylamino]-2,4-dioxobutanoate |
|---|---|
| PubChem CID | 90684752 |
| Molecular Formula | C15H18FNO4 |
| Molecular Weight | 295.31 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | methyl 4-[(4-fluorophenyl)methyl-propan-2-ylamino]-2,4-dioxobutanoate |
| SMILES | COC(=O)C(=O)CC(=O)N(Cc1ccc(F)cc1)C(C)C |
| InChI | InChI=1S/C15H18FNO4/c1-10(2)17(9-11-4-6-12(16)7-5-11)14(19)8-13(18)15(20)21-3/h4-7,10H,8-9H2,1-3H3 |
| InChIKey | LBOKHZUQGUSQKV-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.31 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|