C20H29NO4 — CID 505548
tert-butyl 2,4-dioxo-4-[3-phenylpropyl(propyl)amino]butanoate (PubChem CID 505548) has the molecular formula C20H29NO4 and a molecular weight of 347.45 g/mol. Its IUPAC name is tert-butyl 2,4-dioxo-4-[3-phenylpropyl(propyl)amino]butanoate.
| Compound Name | tert-butyl 2,4-dioxo-4-[3-phenylpropyl(propyl)amino]butanoate |
|---|---|
| PubChem CID | 505548 |
| Molecular Formula | C20H29NO4 |
| Molecular Weight | 347.45 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | tert-butyl 2,4-dioxo-4-[3-phenylpropyl(propyl)amino]butanoate |
| SMILES | CCCN(CCCc1ccccc1)C(=O)CC(=O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H29NO4/c1-5-13-21(14-9-12-16-10-7-6-8-11-16)18(23)15-17(22)19(24)25-20(2,3)4/h6-8,10-11H,5,9,12-15H2,1-4H3 |
| InChIKey | QCBAFSWBKPNNQX-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.45 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|