C19H17F2NO4 — CID 90783513
methyl 4-[bis[(4-fluorophenyl)methyl]amino]-2,4-dioxobutanoate (PubChem CID 90783513) has the molecular formula C19H17F2NO4 and a molecular weight of 361.34 g/mol. Its IUPAC name is methyl 4-[bis[(4-fluorophenyl)methyl]amino]-2,4-dioxobutanoate.
| Compound Name | methyl 4-[bis[(4-fluorophenyl)methyl]amino]-2,4-dioxobutanoate |
|---|---|
| PubChem CID | 90783513 |
| Molecular Formula | C19H17F2NO4 |
| Molecular Weight | 361.34 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | methyl 4-[bis[(4-fluorophenyl)methyl]amino]-2,4-dioxobutanoate |
| SMILES | COC(=O)C(=O)CC(=O)N(Cc1ccc(F)cc1)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C19H17F2NO4/c1-26-19(25)17(23)10-18(24)22(11-13-2-6-15(20)7-3-13)12-14-4-8-16(21)9-5-14/h2-9H,10-12H2,1H3 |
| InChIKey | JHOIDYSAMZTSHD-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.34 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|