C28H27F2NO4 — CID 6478559
tert-butyl 4-[[(E)-3-(2,4-difluorophenyl)prop-2-enyl]-(naphthalen-2-ylmethyl)amino]-2,4-dioxobutanoate (PubChem CID 6478559) has the molecular formula C28H27F2NO4 and a molecular weight of 479.52 g/mol. Its IUPAC name is tert-butyl 4-[[(E)-3-(2,4-difluorophenyl)prop-2-enyl]-(naphthalen-2-ylmethyl)amino]-2,4-dioxobutanoate.
| Compound Name | tert-butyl 4-[[(E)-3-(2,4-difluorophenyl)prop-2-enyl]-(naphthalen-2-ylmethyl)amino]-2,4-dioxobutanoate |
|---|---|
| PubChem CID | 6478559 |
| Molecular Formula | C28H27F2NO4 |
| Molecular Weight | 479.52 g/mol |
| Exact Mass | 479.19 |
| IUPAC Name | tert-butyl 4-[[(E)-3-(2,4-difluorophenyl)prop-2-enyl]-(naphthalen-2-ylmethyl)amino]-2,4-dioxobutanoate |
| SMILES | CC(C)(C)OC(=O)C(=O)CC(=O)N(C/C=C/c1ccc(F)cc1F)Cc1ccc2ccccc2c1 |
| InChI | InChI=1S/C28H27F2NO4/c1-28(2,3)35-27(34)25(32)17-26(33)31(14-6-9-21-12-13-23(29)16-24(21)30)18-19-10-11-20-7-4-5-8-22(20)15-19/h4-13,15-16H,14,17-18H2,1-3H3/b9-6+ |
| InChIKey | NDVXXKPALYJBBC-RMKNXTFCSA-N |
| XLogP | 5.46 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.52 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|