C19H21NO4 — CID 504934
4-[2-methylpropyl(naphthalen-2-ylmethyl)amino]-2,4-dioxobutanoic acid (PubChem CID 504934) has the molecular formula C19H21NO4 and a molecular weight of 327.38 g/mol. Its IUPAC name is 4-[2-methylpropyl(naphthalen-2-ylmethyl)amino]-2,4-dioxobutanoic acid.
| Compound Name | 4-[2-methylpropyl(naphthalen-2-ylmethyl)amino]-2,4-dioxobutanoic acid |
|---|---|
| PubChem CID | 504934 |
| Molecular Formula | C19H21NO4 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | 4-[2-methylpropyl(naphthalen-2-ylmethyl)amino]-2,4-dioxobutanoic acid |
| SMILES | CC(C)CN(Cc1ccc2ccccc2c1)C(=O)CC(=O)C(=O)O |
| InChI | InChI=1S/C19H21NO4/c1-13(2)11-20(18(22)10-17(21)19(23)24)12-14-7-8-15-5-3-4-6-16(15)9-14/h3-9,13H,10-12H2,1-2H3,(H,23,24) |
| InChIKey | LQUIXALDWFKUJO-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|