C24H21F2NO4 — CID 504932
4-[3-(2,4-difluorophenyl)propyl-(naphthalen-2-ylmethyl)amino]-2,4-dioxobutanoic acid (PubChem CID 504932) has the molecular formula C24H21F2NO4 and a molecular weight of 425.43 g/mol. Its IUPAC name is 4-[3-(2,4-difluorophenyl)propyl-(naphthalen-2-ylmethyl)amino]-2,4-dioxobutanoic acid.
| Compound Name | 4-[3-(2,4-difluorophenyl)propyl-(naphthalen-2-ylmethyl)amino]-2,4-dioxobutanoic acid |
|---|---|
| PubChem CID | 504932 |
| Molecular Formula | C24H21F2NO4 |
| Molecular Weight | 425.43 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | 4-[3-(2,4-difluorophenyl)propyl-(naphthalen-2-ylmethyl)amino]-2,4-dioxobutanoic acid |
| SMILES | O=C(O)C(=O)CC(=O)N(CCCc1ccc(F)cc1F)Cc1ccc2ccccc2c1 |
| InChI | InChI=1S/C24H21F2NO4/c25-20-10-9-18(21(26)13-20)6-3-11-27(23(29)14-22(28)24(30)31)15-16-7-8-17-4-1-2-5-19(17)12-16/h1-2,4-5,7-10,12-13H,3,6,11,14-15H2,(H,30,31) |
| InChIKey | WGVYHYFXXMOWDG-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.43 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|