C23H15F6NO4 — CID 504941
4-[N-(naphthalen-2-ylmethyl)-3,5-bis(trifluoromethyl)anilino]-2,4-dioxobutanoic acid (PubChem CID 504941) has the molecular formula C23H15F6NO4 and a molecular weight of 483.36 g/mol. Its IUPAC name is 4-[N-(naphthalen-2-ylmethyl)-3,5-bis(trifluoromethyl)anilino]-2,4-dioxobutanoic acid.
| Compound Name | 4-[N-(naphthalen-2-ylmethyl)-3,5-bis(trifluoromethyl)anilino]-2,4-dioxobutanoic acid |
|---|---|
| PubChem CID | 504941 |
| Molecular Formula | C23H15F6NO4 |
| Molecular Weight | 483.36 g/mol |
| Exact Mass | 483.09 |
| IUPAC Name | 4-[N-(naphthalen-2-ylmethyl)-3,5-bis(trifluoromethyl)anilino]-2,4-dioxobutanoic acid |
| SMILES | O=C(O)C(=O)CC(=O)N(Cc1ccc2ccccc2c1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H15F6NO4/c24-22(25,26)16-8-17(23(27,28)29)10-18(9-16)30(20(32)11-19(31)21(33)34)12-13-5-6-14-3-1-2-4-15(14)7-13/h1-10H,11-12H2,(H,33,34) |
| InChIKey | GKKGPFDVMLPEHY-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.36 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|