C27H23F6NO4 — CID 505590
tert-butyl 4-[N-(naphthalen-2-ylmethyl)-3,5-bis(trifluoromethyl)anilino]-2,4-dioxobutanoate (PubChem CID 505590) has the molecular formula C27H23F6NO4 and a molecular weight of 539.47 g/mol. Its IUPAC name is tert-butyl 4-[N-(naphthalen-2-ylmethyl)-3,5-bis(trifluoromethyl)anilino]-2,4-dioxobutanoate.
| Compound Name | tert-butyl 4-[N-(naphthalen-2-ylmethyl)-3,5-bis(trifluoromethyl)anilino]-2,4-dioxobutanoate |
|---|---|
| PubChem CID | 505590 |
| Molecular Formula | C27H23F6NO4 |
| Molecular Weight | 539.47 g/mol |
| Exact Mass | 539.15 |
| IUPAC Name | tert-butyl 4-[N-(naphthalen-2-ylmethyl)-3,5-bis(trifluoromethyl)anilino]-2,4-dioxobutanoate |
| SMILES | CC(C)(C)OC(=O)C(=O)CC(=O)N(Cc1ccc2ccccc2c1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C27H23F6NO4/c1-25(2,3)38-24(37)22(35)14-23(36)34(15-16-8-9-17-6-4-5-7-18(17)10-16)21-12-19(26(28,29)30)11-20(13-21)27(31,32)33/h4-13H,14-15H2,1-3H3 |
| InChIKey | LJVSJWNFLVTBES-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.47 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|