C26H24F3NO4 — CID 505562
tert-butyl 4-[N-(naphthalen-2-ylmethyl)-3-(trifluoromethyl)anilino]-2,4-dioxobutanoate (PubChem CID 505562) has the molecular formula C26H24F3NO4 and a molecular weight of 471.48 g/mol. Its IUPAC name is tert-butyl 4-[N-(naphthalen-2-ylmethyl)-3-(trifluoromethyl)anilino]-2,4-dioxobutanoate.
| Compound Name | tert-butyl 4-[N-(naphthalen-2-ylmethyl)-3-(trifluoromethyl)anilino]-2,4-dioxobutanoate |
|---|---|
| PubChem CID | 505562 |
| Molecular Formula | C26H24F3NO4 |
| Molecular Weight | 471.48 g/mol |
| Exact Mass | 471.17 |
| IUPAC Name | tert-butyl 4-[N-(naphthalen-2-ylmethyl)-3-(trifluoromethyl)anilino]-2,4-dioxobutanoate |
| SMILES | CC(C)(C)OC(=O)C(=O)CC(=O)N(Cc1ccc2ccccc2c1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C26H24F3NO4/c1-25(2,3)34-24(33)22(31)15-23(32)30(21-10-6-9-20(14-21)26(27,28)29)16-17-11-12-18-7-4-5-8-19(18)13-17/h4-14H,15-16H2,1-3H3 |
| InChIKey | YEOOSVGYGQNXCI-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.48 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|