C24H23NO4 — CID 504906
4-[naphthalen-2-ylmethyl(3-phenylpropyl)amino]-2,4-dioxobutanoic acid (PubChem CID 504906) has the molecular formula C24H23NO4 and a molecular weight of 389.45 g/mol. Its IUPAC name is 4-[naphthalen-2-ylmethyl(3-phenylpropyl)amino]-2,4-dioxobutanoic acid.
| Compound Name | 4-[naphthalen-2-ylmethyl(3-phenylpropyl)amino]-2,4-dioxobutanoic acid |
|---|---|
| PubChem CID | 504906 |
| Molecular Formula | C24H23NO4 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | 4-[naphthalen-2-ylmethyl(3-phenylpropyl)amino]-2,4-dioxobutanoic acid |
| SMILES | O=C(O)C(=O)CC(=O)N(CCCc1ccccc1)Cc1ccc2ccccc2c1 |
| InChI | InChI=1S/C24H23NO4/c26-22(24(28)29)16-23(27)25(14-6-9-18-7-2-1-3-8-18)17-19-12-13-20-10-4-5-11-21(20)15-19/h1-5,7-8,10-13,15H,6,9,14,16-17H2,(H,28,29) |
| InChIKey | AGNKEZAVBPCWQP-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|