C22H17Cl2NO4 — CID 504925
4-[(2,4-dichlorophenyl)methyl-(naphthalen-2-ylmethyl)amino]-2,4-dioxobutanoic acid (PubChem CID 504925) has the molecular formula C22H17Cl2NO4 and a molecular weight of 430.29 g/mol. Its IUPAC name is 4-[(2,4-dichlorophenyl)methyl-(naphthalen-2-ylmethyl)amino]-2,4-dioxobutanoic acid.
| Compound Name | 4-[(2,4-dichlorophenyl)methyl-(naphthalen-2-ylmethyl)amino]-2,4-dioxobutanoic acid |
|---|---|
| PubChem CID | 504925 |
| Molecular Formula | C22H17Cl2NO4 |
| Molecular Weight | 430.29 g/mol |
| Exact Mass | 429.05 |
| IUPAC Name | 4-[(2,4-dichlorophenyl)methyl-(naphthalen-2-ylmethyl)amino]-2,4-dioxobutanoic acid |
| SMILES | O=C(O)C(=O)CC(=O)N(Cc1ccc2ccccc2c1)Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C22H17Cl2NO4/c23-18-8-7-17(19(24)10-18)13-25(21(27)11-20(26)22(28)29)12-14-5-6-15-3-1-2-4-16(15)9-14/h1-10H,11-13H2,(H,28,29) |
| InChIKey | FIPJYWHRGNBPAQ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.29 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|