C22H25NO4 — CID 504929
4-[cyclohexylmethyl(naphthalen-2-ylmethyl)amino]-2,4-dioxobutanoic acid (PubChem CID 504929) has the molecular formula C22H25NO4 and a molecular weight of 367.45 g/mol. Its IUPAC name is 4-[cyclohexylmethyl(naphthalen-2-ylmethyl)amino]-2,4-dioxobutanoic acid.
| Compound Name | 4-[cyclohexylmethyl(naphthalen-2-ylmethyl)amino]-2,4-dioxobutanoic acid |
|---|---|
| PubChem CID | 504929 |
| Molecular Formula | C22H25NO4 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | 4-[cyclohexylmethyl(naphthalen-2-ylmethyl)amino]-2,4-dioxobutanoic acid |
| SMILES | O=C(O)C(=O)CC(=O)N(Cc1ccc2ccccc2c1)CC1CCCCC1 |
| InChI | InChI=1S/C22H25NO4/c24-20(22(26)27)13-21(25)23(14-16-6-2-1-3-7-16)15-17-10-11-18-8-4-5-9-19(18)12-17/h4-5,8-12,16H,1-3,6-7,13-15H2,(H,26,27) |
| InChIKey | CJWSYKRRJXCYHA-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|