C23H21NO4 — CID 504936
4-[naphthalen-2-ylmethyl(2-phenylethyl)amino]-2,4-dioxobutanoic acid (PubChem CID 504936) has the molecular formula C23H21NO4 and a molecular weight of 375.42 g/mol. Its IUPAC name is 4-[naphthalen-2-ylmethyl(2-phenylethyl)amino]-2,4-dioxobutanoic acid.
| Compound Name | 4-[naphthalen-2-ylmethyl(2-phenylethyl)amino]-2,4-dioxobutanoic acid |
|---|---|
| PubChem CID | 504936 |
| Molecular Formula | C23H21NO4 |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | 4-[naphthalen-2-ylmethyl(2-phenylethyl)amino]-2,4-dioxobutanoic acid |
| SMILES | O=C(O)C(=O)CC(=O)N(CCc1ccccc1)Cc1ccc2ccccc2c1 |
| InChI | InChI=1S/C23H21NO4/c25-21(23(27)28)15-22(26)24(13-12-17-6-2-1-3-7-17)16-18-10-11-19-8-4-5-9-20(19)14-18/h1-11,14H,12-13,15-16H2,(H,27,28) |
| InChIKey | JFQVSULWAMNZPC-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|