C21H30FNO3 — CID 58582435
tert-butyl (2S)-4-[(3S)-3-[(4-fluorophenyl)methyl]piperidin-1-yl]-2-methyl-4-oxobutanoate (PubChem CID 58582435) has the molecular formula C21H30FNO3 and a molecular weight of 363.47 g/mol. Its IUPAC name is tert-butyl (2S)-4-[(3S)-3-[(4-fluorophenyl)methyl]piperidin-1-yl]-2-methyl-4-oxobutanoate.
| Compound Name | tert-butyl (2S)-4-[(3S)-3-[(4-fluorophenyl)methyl]piperidin-1-yl]-2-methyl-4-oxobutanoate |
|---|---|
| PubChem CID | 58582435 |
| Molecular Formula | C21H30FNO3 |
| Molecular Weight | 363.47 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | tert-butyl (2S)-4-[(3S)-3-[(4-fluorophenyl)methyl]piperidin-1-yl]-2-methyl-4-oxobutanoate |
| SMILES | C[C@@H](CC(=O)N1CCC[C@@H](Cc2ccc(F)cc2)C1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H30FNO3/c1-15(20(25)26-21(2,3)4)12-19(24)23-11-5-6-17(14-23)13-16-7-9-18(22)10-8-16/h7-10,15,17H,5-6,11-14H2,1-4H3/t15-,17-/m0/s1 |
| InChIKey | ZPIZFMLYLMLCRC-RDJZCZTQSA-N |
| XLogP | 3.97 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.47 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |