C19H16F3NO4 — CID 90863673
methyl 4-[(2,4-difluorophenyl)methyl-[(4-fluorophenyl)methyl]amino]-2,4-dioxobutanoate (PubChem CID 90863673) has the molecular formula C19H16F3NO4 and a molecular weight of 379.33 g/mol. Its IUPAC name is methyl 4-[(2,4-difluorophenyl)methyl-[(4-fluorophenyl)methyl]amino]-2,4-dioxobutanoate.
| Compound Name | methyl 4-[(2,4-difluorophenyl)methyl-[(4-fluorophenyl)methyl]amino]-2,4-dioxobutanoate |
|---|---|
| PubChem CID | 90863673 |
| Molecular Formula | C19H16F3NO4 |
| Molecular Weight | 379.33 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | methyl 4-[(2,4-difluorophenyl)methyl-[(4-fluorophenyl)methyl]amino]-2,4-dioxobutanoate |
| SMILES | COC(=O)C(=O)CC(=O)N(Cc1ccc(F)cc1)Cc1ccc(F)cc1F |
| InChI | InChI=1S/C19H16F3NO4/c1-27-19(26)17(24)9-18(25)23(10-12-2-5-14(20)6-3-12)11-13-4-7-15(21)8-16(13)22/h2-8H,9-11H2,1H3 |
| InChIKey | VDBHNCGZLUMQET-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.33 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|