C26H26N2O — CID 101061737
(3R,4S)-3-phenyl-1-[(1R)-1-phenylethyl]-4-[[(1R)-1-phenylethyl]iminomethyl]azetidin-2-one (PubChem CID 101061737) has the molecular formula C26H26N2O and a molecular weight of 382.51 g/mol. Its IUPAC name is (3R,4S)-3-phenyl-1-[(1R)-1-phenylethyl]-4-[[(1R)-1-phenylethyl]iminomethyl]azetidin-2-one.
| Compound Name | (3R,4S)-3-phenyl-1-[(1R)-1-phenylethyl]-4-[[(1R)-1-phenylethyl]iminomethyl]azetidin-2-one |
|---|---|
| PubChem CID | 101061737 |
| Molecular Formula | C26H26N2O |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | (3R,4S)-3-phenyl-1-[(1R)-1-phenylethyl]-4-[[(1R)-1-phenylethyl]iminomethyl]azetidin-2-one |
| SMILES | C[C@H](c1ccccc1)N1C(=O)[C@H](c2ccccc2)[C@H]1/C=N/[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C26H26N2O/c1-19(21-12-6-3-7-13-21)27-18-24-25(23-16-10-5-11-17-23)26(29)28(24)20(2)22-14-8-4-9-15-22/h3-20,24-25H,1-2H3/b27-18+/t19-,20-,24-,25-/m1/s1 |
| InChIKey | MWTQXDSBROOGCV-IGSBTCBBSA-N |
| XLogP | 5.57 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|