C22H18FNO — CID 122232903
(3S,4R)-1-benzyl-3-fluoro-3,4-diphenylazetidin-2-one (PubChem CID 122232903) has the molecular formula C22H18FNO and a molecular weight of 331.39 g/mol. Its IUPAC name is (3S,4R)-1-benzyl-3-fluoro-3,4-diphenylazetidin-2-one.
| Compound Name | (3S,4R)-1-benzyl-3-fluoro-3,4-diphenylazetidin-2-one |
|---|---|
| PubChem CID | 122232903 |
| Molecular Formula | C22H18FNO |
| Molecular Weight | 331.39 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | (3S,4R)-1-benzyl-3-fluoro-3,4-diphenylazetidin-2-one |
| SMILES | O=C1N(Cc2ccccc2)[C@H](c2ccccc2)[C@@]1(F)c1ccccc1 |
| InChI | InChI=1S/C22H18FNO/c23-22(19-14-8-3-9-15-19)20(18-12-6-2-7-13-18)24(21(22)25)16-17-10-4-1-5-11-17/h1-15,20H,16H2/t20-,22+/m1/s1 |
| InChIKey | APMDSUHXPDHMBH-IRLDBZIGSA-N |
| XLogP | 4.64 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.39 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |