C13H18O5 — CID 10106340
[(1S)-1-[(2S,3S,6S)-6-ethoxy-3-hydroxy-3,6-dihydro-2H-pyran-2-yl]buta-2,3-dienyl] acetate (PubChem CID 10106340) has the molecular formula C13H18O5 and a molecular weight of 254.28 g/mol. Its IUPAC name is [(1S)-1-[(2S,3S,6S)-6-ethoxy-3-hydroxy-3,6-dihydro-2H-pyran-2-yl]buta-2,3-dienyl] acetate.
| Compound Name | [(1S)-1-[(2S,3S,6S)-6-ethoxy-3-hydroxy-3,6-dihydro-2H-pyran-2-yl]buta-2,3-dienyl] acetate |
|---|---|
| PubChem CID | 10106340 |
| Molecular Formula | C13H18O5 |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | [(1S)-1-[(2S,3S,6S)-6-ethoxy-3-hydroxy-3,6-dihydro-2H-pyran-2-yl]buta-2,3-dienyl] acetate |
| SMILES | C=C=C[C@H](OC(C)=O)[C@H]1O[C@H](OCC)C=C[C@@H]1O |
| InChI | InChI=1S/C13H18O5/c1-4-6-11(17-9(3)14)13-10(15)7-8-12(18-13)16-5-2/h6-8,10-13,15H,1,5H2,2-3H3/t10-,11-,12-,13-/m0/s1 |
| InChIKey | FPLLRFJCFAVVPL-CYDGBPFRSA-N |
| XLogP | 0.94 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|