C11H12OS8 — CID 101064871
[2-[4,5-bis(methylsulfanyl)-1,3-dithiol-2-ylidene]-5,6-dihydro-[1,3]dithiolo[4,5-b][1,4]dithiin-5-yl]methanol (PubChem CID 101064871) has the molecular formula C11H12OS8 and a molecular weight of 416.75 g/mol. Its IUPAC name is [2-[4,5-bis(methylsulfanyl)-1,3-dithiol-2-ylidene]-5,6-dihydro-[1,3]dithiolo[4,5-b][1,4]dithiin-5-yl]methanol.
| Compound Name | [2-[4,5-bis(methylsulfanyl)-1,3-dithiol-2-ylidene]-5,6-dihydro-[1,3]dithiolo[4,5-b][1,4]dithiin-5-yl]methanol |
|---|---|
| PubChem CID | 101064871 |
| Molecular Formula | C11H12OS8 |
| Molecular Weight | 416.75 g/mol |
| Exact Mass | 415.87 |
| IUPAC Name | [2-[4,5-bis(methylsulfanyl)-1,3-dithiol-2-ylidene]-5,6-dihydro-[1,3]dithiolo[4,5-b][1,4]dithiin-5-yl]methanol |
| SMILES | CSC1=C(SC)SC(=C2SC3=C(S2)SC(CO)CS3)S1 |
| InChI | InChI=1S/C11H12OS8/c1-13-6-7(14-2)18-10(17-6)11-19-8-9(20-11)16-5(3-12)4-15-8/h5,12H,3-4H2,1-2H3 |
| InChIKey | HOCQKNYJXFQPLE-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.75 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |