C21H32OS8 — CID 10984527
[2-[4,5-bis(hexylsulfanyl)-1,3-dithiol-2-ylidene]-5,6-dihydro-[1,3]dithiolo[4,5-b][1,4]dithiin-5-yl]methanol (PubChem CID 10984527) has the molecular formula C21H32OS8 and a molecular weight of 557.02 g/mol. Its IUPAC name is [2-[4,5-bis(hexylsulfanyl)-1,3-dithiol-2-ylidene]-5,6-dihydro-[1,3]dithiolo[4,5-b][1,4]dithiin-5-yl]methanol.
| Compound Name | [2-[4,5-bis(hexylsulfanyl)-1,3-dithiol-2-ylidene]-5,6-dihydro-[1,3]dithiolo[4,5-b][1,4]dithiin-5-yl]methanol |
|---|---|
| PubChem CID | 10984527 |
| Molecular Formula | C21H32OS8 |
| Molecular Weight | 557.02 g/mol |
| Exact Mass | 556.02 |
| IUPAC Name | [2-[4,5-bis(hexylsulfanyl)-1,3-dithiol-2-ylidene]-5,6-dihydro-[1,3]dithiolo[4,5-b][1,4]dithiin-5-yl]methanol |
| SMILES | CCCCCCSC1=C(SCCCCCC)SC(=C2SC3=C(S2)SC(CO)CS3)S1 |
| InChI | InChI=1S/C21H32OS8/c1-3-5-7-9-11-23-16-17(24-12-10-8-6-4-2)28-20(27-16)21-29-18-19(30-21)26-15(13-22)14-25-18/h15,22H,3-14H2,1-2H3 |
| InChIKey | RLWSCZITVQPPHQ-UHFFFAOYSA-N |
| XLogP | 9.79 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.02 |
| LogP ≤ 5 | 9.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|