C10F12 — CID 101067141
(1R,2R,6R,7S)-1,2,3,4,5,5,6,7,8,9,10,10-dodecafluorotricyclo[5.2.1.02,6]deca-3,8-diene (PubChem CID 101067141) has the molecular formula C10F12 and a molecular weight of 348.09 g/mol. Its IUPAC name is (1R,2R,6R,7S)-1,2,3,4,5,5,6,7,8,9,10,10-dodecafluorotricyclo[5.2.1.02,6]deca-3,8-diene.
| Compound Name | (1R,2R,6R,7S)-1,2,3,4,5,5,6,7,8,9,10,10-dodecafluorotricyclo[5.2.1.02,6]deca-3,8-diene |
|---|---|
| PubChem CID | 101067141 |
| Molecular Formula | C10F12 |
| Molecular Weight | 348.09 g/mol |
| Exact Mass | 347.98 |
| IUPAC Name | (1R,2R,6R,7S)-1,2,3,4,5,5,6,7,8,9,10,10-dodecafluorotricyclo[5.2.1.02,6]deca-3,8-diene |
| SMILES | FC1=C(F)[C@]2(F)[C@](F)(C1(F)F)[C@@]1(F)C(F)=C(F)[C@]2(F)C1(F)F |
| InChI | InChI=1S/C10F12/c11-1-2(12)7(17)9(20)5(15,6(1,16)10(7,21)22)3(13)4(14)8(9,18)19/t5-,6-,7+,9-/m1/s1 |
| InChIKey | JWLKYWSQXBLDPM-JAGXHNFQSA-N |
| XLogP | 4.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.09 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |