C10H4F12 — CID 20802230
1,2,3,4,7,7-hexafluoro-5-(1,1,1,3,3,3-hexafluoropropan-2-yl)bicyclo[2.2.1]hept-2-ene (PubChem CID 20802230) has the molecular formula C10H4F12 and a molecular weight of 352.12 g/mol. Its IUPAC name is 1,2,3,4,7,7-hexafluoro-5-(1,1,1,3,3,3-hexafluoropropan-2-yl)bicyclo[2.2.1]hept-2-ene.
| Compound Name | 1,2,3,4,7,7-hexafluoro-5-(1,1,1,3,3,3-hexafluoropropan-2-yl)bicyclo[2.2.1]hept-2-ene |
|---|---|
| PubChem CID | 20802230 |
| Molecular Formula | C10H4F12 |
| Molecular Weight | 352.12 g/mol |
| Exact Mass | 352.01 |
| IUPAC Name | 1,2,3,4,7,7-hexafluoro-5-(1,1,1,3,3,3-hexafluoropropan-2-yl)bicyclo[2.2.1]hept-2-ene |
| SMILES | FC1=C(F)C2(F)C(C(C(F)(F)F)C(F)(F)F)CC1(F)C2(F)F |
| InChI | InChI=1S/C10H4F12/c11-4-5(12)7(14)2(1-6(4,13)10(7,21)22)3(8(15,16)17)9(18,19)20/h2-3H,1H2 |
| InChIKey | NBPIGBMPXGLJBZ-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.12 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |