C10H11F5 — CID 643687
(1R,2R,4S)-2-[(Z)-1,2,3,3,3-pentafluoroprop-1-enyl]bicyclo[2.2.1]heptane (PubChem CID 643687) has the molecular formula C10H11F5 and a molecular weight of 226.19 g/mol. Its IUPAC name is (1R,2R,4S)-2-[(Z)-1,2,3,3,3-pentafluoroprop-1-enyl]bicyclo[2.2.1]heptane.
| Compound Name | (1R,2R,4S)-2-[(Z)-1,2,3,3,3-pentafluoroprop-1-enyl]bicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 643687 |
| Molecular Formula | C10H11F5 |
| Molecular Weight | 226.19 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | (1R,2R,4S)-2-[(Z)-1,2,3,3,3-pentafluoroprop-1-enyl]bicyclo[2.2.1]heptane |
| SMILES | F/C(=C(\F)C(F)(F)F)[C@@H]1C[C@H]2CC[C@@H]1C2 |
| InChI | InChI=1S/C10H11F5/c11-8(9(12)10(13,14)15)7-4-5-1-2-6(7)3-5/h5-7H,1-4H2/b9-8-/t5-,6+,7+/m0/s1 |
| InChIKey | ARWIWGSMGMBPDF-RUKNSNNVSA-N |
| XLogP | 4.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.19 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |