C20H16BrCl4NO9 — CID 101068144
[(2R,3S,4R,5R,6S)-3,4-diacetyloxy-6-bromo-5-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)oxan-2-yl]methyl acetate (PubChem CID 101068144) has the molecular formula C20H16BrCl4NO9 and a molecular weight of 636.06 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6S)-3,4-diacetyloxy-6-bromo-5-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R,6S)-3,4-diacetyloxy-6-bromo-5-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 101068144 |
| Molecular Formula | C20H16BrCl4NO9 |
| Molecular Weight | 636.06 g/mol |
| Exact Mass | 632.88 |
| IUPAC Name | [(2R,3S,4R,5R,6S)-3,4-diacetyloxy-6-bromo-5-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](Br)[C@H](N2C(=O)c3c(Cl)c(Cl)c(Cl)c(Cl)c3C2=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C20H16BrCl4NO9/c1-5(27)32-4-8-16(33-6(2)28)17(34-7(3)29)15(18(21)35-8)26-19(30)9-10(20(26)31)12(23)14(25)13(24)11(9)22/h8,15-18H,4H2,1-3H3/t8-,15-,16-,17-,18-/m1/s1 |
| InChIKey | IDKMVYIZIIGFMT-HHACZPCISA-N |
| XLogP | 3.81 |
| TPSA | 125.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.06 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|