C15H22N5O6 — CID 101069459
CID 101069459 (PubChem CID 101069459) has the molecular formula C15H22N5O6 and a molecular weight of 368.37 g/mol.
| Compound Name | CID 101069459 |
|---|---|
| PubChem CID | 101069459 |
| Molecular Formula | C15H22N5O6 |
| Molecular Weight | 368.37 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | — |
| SMILES | COc1ncnc2c1nc(N([O])C(C)(C)C)n2[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C15H22N5O6/c1-15(2,3)20(24)14-18-8-11(16-6-17-12(8)25-4)19(14)13-10(23)9(22)7(5-21)26-13/h6-7,9-10,13,21-23H,5H2,1-4H3/t7-,9-,10-,13-/m1/s1 |
| InChIKey | CBOLLRRODFVKLV-QYVSTXNMSA-N |
| XLogP | -0.60 |
| TPSA | 145.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.37 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|