C18H23NO4 — CID 101069813
(4S)-3-[(2R)-2-phenylmethoxypent-4-enoyl]-4-propan-2-yl-1,3-oxazolidin-2-one (PubChem CID 101069813) has the molecular formula C18H23NO4 and a molecular weight of 317.38 g/mol. Its IUPAC name is (4S)-3-[(2R)-2-phenylmethoxypent-4-enoyl]-4-propan-2-yl-1,3-oxazolidin-2-one.
| Compound Name | (4S)-3-[(2R)-2-phenylmethoxypent-4-enoyl]-4-propan-2-yl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 101069813 |
| Molecular Formula | C18H23NO4 |
| Molecular Weight | 317.38 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | (4S)-3-[(2R)-2-phenylmethoxypent-4-enoyl]-4-propan-2-yl-1,3-oxazolidin-2-one |
| SMILES | C=CC[C@@H](OCc1ccccc1)C(=O)N1C(=O)OC[C@@H]1C(C)C |
| InChI | InChI=1S/C18H23NO4/c1-4-8-16(22-11-14-9-6-5-7-10-14)17(20)19-15(13(2)3)12-23-18(19)21/h4-7,9-10,13,15-16H,1,8,11-12H2,2-3H3/t15-,16-/m1/s1 |
| InChIKey | HQYMUZSPILBRMG-HZPDHXFCSA-N |
| XLogP | 3.15 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.38 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|