C11H15NO2 — CID 101072048
1-cyclopropyl-3-(2,3-dihydropyrrol-1-yl)-2-methylpropane-1,3-dione (PubChem CID 101072048) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is 1-cyclopropyl-3-(2,3-dihydropyrrol-1-yl)-2-methylpropane-1,3-dione.
| Compound Name | 1-cyclopropyl-3-(2,3-dihydropyrrol-1-yl)-2-methylpropane-1,3-dione |
|---|---|
| PubChem CID | 101072048 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | 1-cyclopropyl-3-(2,3-dihydropyrrol-1-yl)-2-methylpropane-1,3-dione |
| SMILES | CC(C(=O)C1CC1)C(=O)N1C=CCC1 |
| InChI | InChI=1S/C11H15NO2/c1-8(10(13)9-4-5-9)11(14)12-6-2-3-7-12/h2,6,8-9H,3-5,7H2,1H3 |
| InChIKey | IOVBBNFKWVSEGE-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|