C12H21NO — CID 123668602
1-(2,3-dihydropyrrol-1-yl)-3,5-dimethylhexan-1-one (PubChem CID 123668602) has the molecular formula C12H21NO and a molecular weight of 195.31 g/mol. Its IUPAC name is 1-(2,3-dihydropyrrol-1-yl)-3,5-dimethylhexan-1-one.
| Compound Name | 1-(2,3-dihydropyrrol-1-yl)-3,5-dimethylhexan-1-one |
|---|---|
| PubChem CID | 123668602 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | 1-(2,3-dihydropyrrol-1-yl)-3,5-dimethylhexan-1-one |
| SMILES | CC(C)CC(C)CC(=O)N1C=CCC1 |
| InChI | InChI=1S/C12H21NO/c1-10(2)8-11(3)9-12(14)13-6-4-5-7-13/h4,6,10-11H,5,7-9H2,1-3H3 |
| InChIKey | PMHYALVEYCNWLG-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |