C14H21NO — CID 46854022
(3R,4S)-1-methyl-4-(2-methylbut-3-en-2-yl)-3-prop-2-enyl-3,4-dihydropyridin-2-one (PubChem CID 46854022) has the molecular formula C14H21NO and a molecular weight of 219.33 g/mol. Its IUPAC name is (3R,4S)-1-methyl-4-(2-methylbut-3-en-2-yl)-3-prop-2-enyl-3,4-dihydropyridin-2-one.
| Compound Name | (3R,4S)-1-methyl-4-(2-methylbut-3-en-2-yl)-3-prop-2-enyl-3,4-dihydropyridin-2-one |
|---|---|
| PubChem CID | 46854022 |
| Molecular Formula | C14H21NO |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | (3R,4S)-1-methyl-4-(2-methylbut-3-en-2-yl)-3-prop-2-enyl-3,4-dihydropyridin-2-one |
| SMILES | C=CC[C@H]1C(=O)N(C)C=C[C@@H]1C(C)(C)C=C |
| InChI | InChI=1S/C14H21NO/c1-6-8-11-12(14(3,4)7-2)9-10-15(5)13(11)16/h6-7,9-12H,1-2,8H2,3-5H3/t11-,12+/m1/s1 |
| InChIKey | DXCZTFCFJQVWGR-NEPJUHHUSA-N |
| XLogP | 2.99 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|