C15H21NO2 — CID 135015529
(3R,4S)-1-(3-oxobutyl)-3,4-bis(prop-2-enyl)-3,4-dihydropyridin-2-one (PubChem CID 135015529) has the molecular formula C15H21NO2 and a molecular weight of 247.34 g/mol. Its IUPAC name is (3R,4S)-1-(3-oxobutyl)-3,4-bis(prop-2-enyl)-3,4-dihydropyridin-2-one.
| Compound Name | (3R,4S)-1-(3-oxobutyl)-3,4-bis(prop-2-enyl)-3,4-dihydropyridin-2-one |
|---|---|
| PubChem CID | 135015529 |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | (3R,4S)-1-(3-oxobutyl)-3,4-bis(prop-2-enyl)-3,4-dihydropyridin-2-one |
| SMILES | C=CC[C@H]1C=CN(CCC(C)=O)C(=O)[C@@H]1CC=C |
| InChI | InChI=1S/C15H21NO2/c1-4-6-13-9-11-16(10-8-12(3)17)15(18)14(13)7-5-2/h4-5,9,11,13-14H,1-2,6-8,10H2,3H3/t13-,14+/m0/s1 |
| InChIKey | OWFOQDKTZYBGFL-UONOGXRCSA-N |
| XLogP | 2.71 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|