C9H13NO2 — CID 91422016
1-(1-acetyl-3,4-dihydro-2H-pyridin-4-yl)ethanone (PubChem CID 91422016) has the molecular formula C9H13NO2 and a molecular weight of 167.21 g/mol. Its IUPAC name is 1-(1-acetyl-3,4-dihydro-2H-pyridin-4-yl)ethanone.
| Compound Name | 1-(1-acetyl-3,4-dihydro-2H-pyridin-4-yl)ethanone |
|---|---|
| PubChem CID | 91422016 |
| Molecular Formula | C9H13NO2 |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | 1-(1-acetyl-3,4-dihydro-2H-pyridin-4-yl)ethanone |
| SMILES | CC(=O)C1C=CN(C(C)=O)CC1 |
| InChI | InChI=1S/C9H13NO2/c1-7(11)9-3-5-10(6-4-9)8(2)12/h3,5,9H,4,6H2,1-2H3 |
| InChIKey | PZKOPSZOSYGFSZ-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |