C10H17NO — CID 91212846
1,4-diethyl-4,5-dihydro-3H-azepin-2-one (PubChem CID 91212846) has the molecular formula C10H17NO and a molecular weight of 167.25 g/mol. Its IUPAC name is 1,4-diethyl-4,5-dihydro-3H-azepin-2-one.
| Compound Name | 1,4-diethyl-4,5-dihydro-3H-azepin-2-one |
|---|---|
| PubChem CID | 91212846 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | 1,4-diethyl-4,5-dihydro-3H-azepin-2-one |
| SMILES | CCC1CC=CN(CC)C(=O)C1 |
| InChI | InChI=1S/C10H17NO/c1-3-9-6-5-7-11(4-2)10(12)8-9/h5,7,9H,3-4,6,8H2,1-2H3 |
| InChIKey | PYTPCDGFQYSGQI-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |