C16H25NO2 — CID 135015530
(3R,4S)-1-(3-hydroxy-3-methylbutyl)-3,4-bis(prop-2-enyl)-3,4-dihydropyridin-2-one (PubChem CID 135015530) has the molecular formula C16H25NO2 and a molecular weight of 263.38 g/mol. Its IUPAC name is (3R,4S)-1-(3-hydroxy-3-methylbutyl)-3,4-bis(prop-2-enyl)-3,4-dihydropyridin-2-one.
| Compound Name | (3R,4S)-1-(3-hydroxy-3-methylbutyl)-3,4-bis(prop-2-enyl)-3,4-dihydropyridin-2-one |
|---|---|
| PubChem CID | 135015530 |
| Molecular Formula | C16H25NO2 |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | (3R,4S)-1-(3-hydroxy-3-methylbutyl)-3,4-bis(prop-2-enyl)-3,4-dihydropyridin-2-one |
| SMILES | C=CC[C@H]1C=CN(CCC(C)(C)O)C(=O)[C@@H]1CC=C |
| InChI | InChI=1S/C16H25NO2/c1-5-7-13-9-11-17(12-10-16(3,4)19)15(18)14(13)8-6-2/h5-6,9,11,13-14,19H,1-2,7-8,10,12H2,3-4H3/t13-,14+/m0/s1 |
| InChIKey | ZHZCEDADHLWELV-UONOGXRCSA-N |
| XLogP | 2.89 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|