C13H17NO2 — CID 135015255
(4aS,8aR)-2-(3-oxobutyl)-4a,5,8,8a-tetrahydroisoquinolin-1-one (PubChem CID 135015255) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is (4aS,8aR)-2-(3-oxobutyl)-4a,5,8,8a-tetrahydroisoquinolin-1-one.
| Compound Name | (4aS,8aR)-2-(3-oxobutyl)-4a,5,8,8a-tetrahydroisoquinolin-1-one |
|---|---|
| PubChem CID | 135015255 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | (4aS,8aR)-2-(3-oxobutyl)-4a,5,8,8a-tetrahydroisoquinolin-1-one |
| SMILES | CC(=O)CCN1C=C[C@@H]2CC=CC[C@H]2C1=O |
| InChI | InChI=1S/C13H17NO2/c1-10(15)6-8-14-9-7-11-4-2-3-5-12(11)13(14)16/h2-3,7,9,11-12H,4-6,8H2,1H3/t11-,12+/m0/s1 |
| InChIKey | PLBUWBWSDMPUSD-NWDGAFQWSA-N |
| XLogP | 1.90 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|