C12H17NO — CID 46854023
(4aS,8aR)-2,5,5-trimethyl-8,8a-dihydro-4aH-isoquinolin-1-one (PubChem CID 46854023) has the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. Its IUPAC name is (4aS,8aR)-2,5,5-trimethyl-8,8a-dihydro-4aH-isoquinolin-1-one.
| Compound Name | (4aS,8aR)-2,5,5-trimethyl-8,8a-dihydro-4aH-isoquinolin-1-one |
|---|---|
| PubChem CID | 46854023 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | (4aS,8aR)-2,5,5-trimethyl-8,8a-dihydro-4aH-isoquinolin-1-one |
| SMILES | CN1C=C[C@H]2[C@@H](CC=CC2(C)C)C1=O |
| InChI | InChI=1S/C12H17NO/c1-12(2)7-4-5-9-10(12)6-8-13(3)11(9)14/h4,6-10H,5H2,1-3H3/t9-,10+/m1/s1 |
| InChIKey | UBVNSLVKLVQDAP-ZJUUUORDSA-N |
| XLogP | 2.19 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|