C13H25NO — CID 13183965
(E)-N,N-diethyl-3-propylhex-4-enamide (PubChem CID 13183965) has the molecular formula C13H25NO and a molecular weight of 211.35 g/mol. Its IUPAC name is (E)-N,N-diethyl-3-propylhex-4-enamide.
| Compound Name | (E)-N,N-diethyl-3-propylhex-4-enamide |
|---|---|
| PubChem CID | 13183965 |
| Molecular Formula | C13H25NO |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.19 |
| IUPAC Name | (E)-N,N-diethyl-3-propylhex-4-enamide |
| SMILES | C/C=C/C(CCC)CC(=O)N(CC)CC |
| InChI | InChI=1S/C13H25NO/c1-5-9-12(10-6-2)11-13(15)14(7-3)8-4/h5,9,12H,6-8,10-11H2,1-4H3/b9-5+ |
| InChIKey | OWPCJCTXBFRUBZ-WEVVVXLNSA-N |
| XLogP | 3.24 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|