C12H19NO — CID 3047538
cyclohexyl(3,6-dihydro-2H-pyridin-1-yl)methanone (PubChem CID 3047538) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is cyclohexyl(3,6-dihydro-2H-pyridin-1-yl)methanone.
| Compound Name | cyclohexyl(3,6-dihydro-2H-pyridin-1-yl)methanone |
|---|---|
| PubChem CID | 3047538 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | cyclohexyl(3,6-dihydro-2H-pyridin-1-yl)methanone |
| SMILES | O=C(C1CCCCC1)N1CC=CCC1 |
| InChI | InChI=1S/C12H19NO/c14-12(11-7-3-1-4-8-11)13-9-5-2-6-10-13/h2,5,11H,1,3-4,6-10H2 |
| InChIKey | WLAJTKMPLRCMSD-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|